About 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol
3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol (PubChem CID 66105091) has the molecular formula C8H16F3NOS
and a molecular weight of 231.28 g/mol. Its IUPAC name is 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol |
| PubChem CID | 66105091 |
| Molecular Formula | C8H16F3NOS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol |
| SMILES | CC(CO)CSC(C(C)N)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NOS/c1-5(3-13)4-14-7(6(2)12)8(9,10)11/h5-7,13H,3-4,12H2,1-2H3 |
| InChIKey | HJZIRUMHGBVZKM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol?
The IUPAC name of 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol (CID 66105091) is 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol.
What is the SMILES notation for 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol?
The canonical SMILES for 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol is CC(CO)CSC(C(C)N)C(F)(F)F.
What is the InChIKey of 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol?
The InChIKey is HJZIRUMHGBVZKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NOS/c1-5(3-13)4-14-7(6(2)12)8(9,10)11/h5-7,13H,3-4,12H2,1-2H3.
What are the key properties of 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol?
3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol has a molecular weight of 231.28 g/mol, XLogP of 1.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1,1,1-trifluorobutan-2-yl)sulfanyl-2-methylpropan-1-ol is sourced from PubChem (CID 66105091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).