About 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol
2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol (PubChem CID 66105296) has the molecular formula C6H10N2OS2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol.
Molecular Properties
| Compound Name | 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol |
| PubChem CID | 66105296 |
| Molecular Formula | C6H10N2OS2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol |
| SMILES | CC(CO)CSc1ncns1 |
| InChI | InChI=1S/C6H10N2OS2/c1-5(2-9)3-10-6-7-4-8-11-6/h4-5,9H,2-3H2,1H3 |
| InChIKey | FTYWFWFPZIUJFB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol?
The IUPAC name of 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol (CID 66105296) is 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol.
What is the SMILES notation for 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol?
The canonical SMILES for 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol is CC(CO)CSc1ncns1.
What is the InChIKey of 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol?
The InChIKey is FTYWFWFPZIUJFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS2/c1-5(2-9)3-10-6-7-4-8-11-6/h4-5,9H,2-3H2,1H3.
What are the key properties of 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol?
2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol has a molecular weight of 190.29 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)propan-1-ol is sourced from PubChem (CID 66105296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).