About 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine
2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine (PubChem CID 66106156) has the molecular formula C7H14N4S
and a molecular weight of 186.28 g/mol. Its IUPAC name is 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine.
Analyze 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine?
The IUPAC name of 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine (CID 66106156) is 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine.
What is the SMILES notation for 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine?
The canonical SMILES for 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine is CC(CCN)CNc1ncns1.
What is the InChIKey of 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine?
The InChIKey is APIYNOKKGUNMAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4S/c1-6(2-3-8)4-9-7-10-5-11-12-7/h5-6H,2-4,8H2,1H3,(H,9,10,11).
What are the key properties of 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine?
2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine has a molecular weight of 186.28 g/mol, XLogP of 0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(1,2,4-thiadiazol-5-yl)butane-1,4-diamine is sourced from PubChem (CID 66106156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).