About 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one
4-cyclohexyl-5,5-dimethylpyrrolidin-2-one (PubChem CID 66106336) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one |
| PubChem CID | 66106336 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one |
| SMILES | CC1(C)NC(=O)CC1C1CCCCC1 |
| InChI | InChI=1S/C12H21NO/c1-12(2)10(8-11(14)13-12)9-6-4-3-5-7-9/h9-10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | VLSUMAUYUHAGSM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one?
The IUPAC name of 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one (CID 66106336) is 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one.
What is the SMILES notation for 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one?
The canonical SMILES for 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one is CC1(C)NC(=O)CC1C1CCCCC1.
What is the InChIKey of 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one?
The InChIKey is VLSUMAUYUHAGSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-12(2)10(8-11(14)13-12)9-6-4-3-5-7-9/h9-10H,3-8H2,1-2H3,(H,13,14).
What are the key properties of 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one?
4-cyclohexyl-5,5-dimethylpyrrolidin-2-one has a molecular weight of 195.31 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-5,5-dimethylpyrrolidin-2-one is sourced from PubChem (CID 66106336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).