About 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine
2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine (PubChem CID 66106814) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine |
| PubChem CID | 66106814 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine |
| SMILES | Cc1cccnc1NCC(C)CCN |
| InChI | InChI=1S/C11H19N3/c1-9(5-6-12)8-14-11-10(2)4-3-7-13-11/h3-4,7,9H,5-6,8,12H2,1-2H3,(H,13,14) |
| InChIKey | SNTJZWLNKBXLHQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine?
The IUPAC name of 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine (CID 66106814) is 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine.
What is the SMILES notation for 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine?
The canonical SMILES for 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine is Cc1cccnc1NCC(C)CCN.
What is the InChIKey of 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine?
The InChIKey is SNTJZWLNKBXLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-9(5-6-12)8-14-11-10(2)4-3-7-13-11/h3-4,7,9H,5-6,8,12H2,1-2H3,(H,13,14).
What are the key properties of 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine?
2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine has a molecular weight of 193.29 g/mol, XLogP of 1.79, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(3-methyl-2-pyridinyl)butane-1,4-diamine is sourced from PubChem (CID 66106814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).