About 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one
4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one (PubChem CID 66106985) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one |
| PubChem CID | 66106985 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one |
| SMILES | Cc1ccc(C2CC(=O)NC2(C)C)cc1C |
| InChI | InChI=1S/C14H19NO/c1-9-5-6-11(7-10(9)2)12-8-13(16)15-14(12,3)4/h5-7,12H,8H2,1-4H3,(H,15,16) |
| InChIKey | HTLLQIZBRJPPOK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one?
The IUPAC name of 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one (CID 66106985) is 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one.
What is the SMILES notation for 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one?
The canonical SMILES for 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one is Cc1ccc(C2CC(=O)NC2(C)C)cc1C.
What is the InChIKey of 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one?
The InChIKey is HTLLQIZBRJPPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-9-5-6-11(7-10(9)2)12-8-13(16)15-14(12,3)4/h5-7,12H,8H2,1-4H3,(H,15,16).
What are the key properties of 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one?
4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one has a molecular weight of 217.31 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylphenyl)-5,5-dimethylpyrrolidin-2-one is sourced from PubChem (CID 66106985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).