About 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one
8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one (PubChem CID 66107161) has the molecular formula C8H13NO3S
and a molecular weight of 203.26 g/mol. Its IUPAC name is 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one |
| PubChem CID | 66107161 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCS(=O)(=O)CC2)CN1 |
| InChI | InChI=1S/C8H13NO3S/c10-7-5-8(6-9-7)1-3-13(11,12)4-2-8/h1-6H2,(H,9,10) |
| InChIKey | WXRCDHNXDAYFRK-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one?
The IUPAC name of 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one (CID 66107161) is 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one.
What is the SMILES notation for 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one?
The canonical SMILES for 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one is O=C1CC2(CCS(=O)(=O)CC2)CN1.
What is the InChIKey of 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one?
The InChIKey is WXRCDHNXDAYFRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3S/c10-7-5-8(6-9-7)1-3-13(11,12)4-2-8/h1-6H2,(H,9,10).
What are the key properties of 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one?
8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one has a molecular weight of 203.26 g/mol, XLogP of -0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dioxo-8λ6-thia-2-azaspiro[4.5]decan-3-one is sourced from PubChem (CID 66107161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).