C8H11N3O — CID 66107601
4-(1-methylpyrazol-4-yl)pyrrolidin-2-one (PubChem CID 66107601) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)pyrrolidin-2-one.
| Compound Name | 4-(1-methylpyrazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 66107601 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)pyrrolidin-2-one |
| SMILES | Cn1cc(C2CNC(=O)C2)cn1 |
| InChI | InChI=1S/C8H11N3O/c1-11-5-7(4-10-11)6-2-8(12)9-3-6/h4-6H,2-3H2,1H3,(H,9,12) |
| InChIKey | IFNJOWBFZJNUCY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |