About methyl 4-(1,3-benzothiazol-2-yl)butanoate
methyl 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 661084) has the molecular formula C12H13NO2S
and a molecular weight of 235.31 g/mol. Its IUPAC name is methyl 4-(1,3-benzothiazol-2-yl)butanoate.
Molecular Properties
| Compound Name | methyl 4-(1,3-benzothiazol-2-yl)butanoate |
| PubChem CID | 661084 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | methyl 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | COC(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NO2S/c1-15-12(14)8-4-7-11-13-9-5-2-3-6-10(9)16-11/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | PETPIBQKDRRSJT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(1,3-benzothiazol-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(1,3-benzothiazol-2-yl)butanoate?
The IUPAC name of methyl 4-(1,3-benzothiazol-2-yl)butanoate (CID 661084) is methyl 4-(1,3-benzothiazol-2-yl)butanoate.
What is the SMILES notation for methyl 4-(1,3-benzothiazol-2-yl)butanoate?
The canonical SMILES for methyl 4-(1,3-benzothiazol-2-yl)butanoate is COC(=O)CCCc1nc2ccccc2s1.
What is the InChIKey of methyl 4-(1,3-benzothiazol-2-yl)butanoate?
The InChIKey is PETPIBQKDRRSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2S/c1-15-12(14)8-4-7-11-13-9-5-2-3-6-10(9)16-11/h2-3,5-6H,4,7-8H2,1H3.
What are the key properties of methyl 4-(1,3-benzothiazol-2-yl)butanoate?
methyl 4-(1,3-benzothiazol-2-yl)butanoate has a molecular weight of 235.31 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,3-benzothiazol-2-yl)butanoate is sourced from PubChem (CID 661084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).