About 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea
1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea (PubChem CID 661085) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea |
| PubChem CID | 661085 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea |
| SMILES | CC(C)=CCC(C)(C)CNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H30N2O/c1-13(2)10-11-16(3,4)12-17-15(19)18-14-8-6-5-7-9-14/h10,14H,5-9,11-12H2,1-4H3,(H2,17,18,19) |
| InChIKey | HBEDAKQHTXRWMU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea?
The IUPAC name of 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea (CID 661085) is 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea.
What is the SMILES notation for 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea?
The canonical SMILES for 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea is CC(C)=CCC(C)(C)CNC(=O)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea?
The InChIKey is HBEDAKQHTXRWMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O/c1-13(2)10-11-16(3,4)12-17-15(19)18-14-8-6-5-7-9-14/h10,14H,5-9,11-12H2,1-4H3,(H2,17,18,19).
What are the key properties of 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea?
1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea has a molecular weight of 266.43 g/mol, XLogP of 4.00, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-(2,2,5-trimethylhex-4-enyl)urea is sourced from PubChem (CID 661085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).