C13H23NO — CID 66108931
1,1,8,8-tetramethyl-2-azaspiro[4.5]decan-3-one (PubChem CID 66108931) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1,1,8,8-tetramethyl-2-azaspiro[4.5]decan-3-one.
| Compound Name | 1,1,8,8-tetramethyl-2-azaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 66108931 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1,1,8,8-tetramethyl-2-azaspiro[4.5]decan-3-one |
| SMILES | CC1(C)CCC2(CC1)CC(=O)NC2(C)C |
| InChI | InChI=1S/C13H23NO/c1-11(2)5-7-13(8-6-11)9-10(15)14-12(13,3)4/h5-9H2,1-4H3,(H,14,15) |
| InChIKey | QUXPYBFHQPRBRM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |