About 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline
5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline (PubChem CID 66111141) has the molecular formula C12H12BrFN4
and a molecular weight of 311.16 g/mol. Its IUPAC name is 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline.
Molecular Properties
| Compound Name | 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline |
| PubChem CID | 66111141 |
| Molecular Formula | C12H12BrFN4 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline |
| SMILES | Nc1cc(Br)c(F)cc1N1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H12BrFN4/c13-8-5-10(15)11(6-9(8)14)18-4-3-17-2-1-16-12(17)7-18/h1-2,5-6H,3-4,7,15H2 |
| InChIKey | YLELFLMIQUGPLI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline?
The IUPAC name of 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline (CID 66111141) is 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline.
What is the SMILES notation for 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline?
The canonical SMILES for 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline is Nc1cc(Br)c(F)cc1N1CCn2ccnc2C1.
What is the InChIKey of 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline?
The InChIKey is YLELFLMIQUGPLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrFN4/c13-8-5-10(15)11(6-9(8)14)18-4-3-17-2-1-16-12(17)7-18/h1-2,5-6H,3-4,7,15H2.
What are the key properties of 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline?
5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline has a molecular weight of 311.16 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-fluoroaniline is sourced from PubChem (CID 66111141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).