C25H46N8O — CID 6611169
6-morpholin-4-yl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 6611169) has the molecular formula C25H46N8O and a molecular weight of 474.70 g/mol. Its IUPAC name is 6-morpholin-4-yl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-morpholin-4-yl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6611169 |
| Molecular Formula | C25H46N8O |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.38 |
| IUPAC Name | 6-morpholin-4-yl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)CC(Nc2nc(NC3CC(C)(C)NC(C)(C)C3)nc(N3CCOCC3)n2)CC(C)(C)N1 |
| InChI | InChI=1S/C25H46N8O/c1-22(2)13-17(14-23(3,4)31-22)26-19-28-20(30-21(29-19)33-9-11-34-12-10-33)27-18-15-24(5,6)32-25(7,8)16-18/h17-18,31-32H,9-16H2,1-8H3,(H2,26,27,28,29,30) |
| InChIKey | RSCDYKOSFKPWIK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |