C19H31NO5 — CID 6611190
16-benzyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane (PubChem CID 6611190) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 16-benzyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane.
| Compound Name | 16-benzyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane |
|---|---|
| PubChem CID | 6611190 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 16-benzyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane |
| SMILES | c1ccc(CN2CCOCCOCCOCCOCCOCC2)cc1 |
| InChI | InChI=1S/C19H31NO5/c1-2-4-19(5-3-1)18-20-6-8-21-10-12-23-14-16-25-17-15-24-13-11-22-9-7-20/h1-5H,6-18H2 |
| InChIKey | VZPRAOYHVHWTJR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |