C16H16BrFN2 — CID 66112076
1-N-benzyl-4-bromo-1-N-cyclopropyl-5-fluorobenzene-1,2-diamine (PubChem CID 66112076) has the molecular formula C16H16BrFN2 and a molecular weight of 335.22 g/mol. Its IUPAC name is 1-N-benzyl-4-bromo-1-N-cyclopropyl-5-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-benzyl-4-bromo-1-N-cyclopropyl-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 66112076 |
| Molecular Formula | C16H16BrFN2 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1-N-benzyl-4-bromo-1-N-cyclopropyl-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(Br)c(F)cc1N(Cc1ccccc1)C1CC1 |
| InChI | InChI=1S/C16H16BrFN2/c17-13-8-15(19)16(9-14(13)18)20(12-6-7-12)10-11-4-2-1-3-5-11/h1-5,8-9,12H,6-7,10,19H2 |
| InChIKey | WLYFCSGJPCQFMW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|