C15H17Cl2FN2O — CID 66112392
5-chloro-2-(1-chloroethyl)-6-fluoro-1-(2-methoxycyclopentyl)benzimidazole (PubChem CID 66112392) has the molecular formula C15H17Cl2FN2O and a molecular weight of 331.22 g/mol. Its IUPAC name is 5-chloro-2-(1-chloroethyl)-6-fluoro-1-(2-methoxycyclopentyl)benzimidazole.
| Compound Name | 5-chloro-2-(1-chloroethyl)-6-fluoro-1-(2-methoxycyclopentyl)benzimidazole |
|---|---|
| PubChem CID | 66112392 |
| Molecular Formula | C15H17Cl2FN2O |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 5-chloro-2-(1-chloroethyl)-6-fluoro-1-(2-methoxycyclopentyl)benzimidazole |
| SMILES | COC1CCCC1n1c(C(C)Cl)nc2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C15H17Cl2FN2O/c1-8(16)15-19-11-6-9(17)10(18)7-13(11)20(15)12-4-3-5-14(12)21-2/h6-8,12,14H,3-5H2,1-2H3 |
| InChIKey | SHLODXGPUMXARI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|