2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid

C15H17NO4 — CID 6611293

IUPAC2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid
SMILESCCc1nc(C)ccc1O.O=C(O)c1ccccc1O
InChIInChI=1S/C8H11NO.C7H6O3/c1-3-7-8(10)5-4-6(2)9-7;8-6-4-2-1-3-5(6)7(9)10/h4-5,10H,3H2,1-2H3;1-4,8H,(H,9,10)
InChIKeyNKBSTKVKKPAYMS-UHFFFAOYSA-N
MW275.30 g/mol
LogP2.75
Rot. Bonds2

About 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid

2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid (PubChem CID 6611293) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid.

Molecular Properties

Compound Name2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid
PubChem CID6611293
Molecular FormulaC15H17NO4
Molecular Weight275.30 g/mol
Exact Mass275.12
IUPAC Name2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid
SMILESCCc1nc(C)ccc1O.O=C(O)c1ccccc1O
InChIInChI=1S/C8H11NO.C7H6O3/c1-3-7-8(10)5-4-6(2)9-7;8-6-4-2-1-3-5(6)7(9)10/h4-5,10H,3H2,1-2H3;1-4,8H,(H,9,10)
InChIKeyNKBSTKVKKPAYMS-UHFFFAOYSA-N
XLogP2.75
TPSA90.65 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.30
LogP ≤ 52.75
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid?
The IUPAC name of 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid (CID 6611293) is 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid.
What is the SMILES notation for 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid?
The canonical SMILES for 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid is CCc1nc(C)ccc1O.O=C(O)c1ccccc1O.
What is the InChIKey of 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid?
The InChIKey is NKBSTKVKKPAYMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C7H6O3/c1-3-7-8(10)5-4-6(2)9-7;8-6-4-2-1-3-5(6)7(9)10/h4-5,10H,3H2,1-2H3;1-4,8H,(H,9,10).
What are the key properties of 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid?
2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid has a molecular weight of 275.30 g/mol, XLogP of 2.75, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid is sourced from PubChem (CID 6611293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).