About 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid
2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid (PubChem CID 6611293) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid |
| PubChem CID | 6611293 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid |
| SMILES | CCc1nc(C)ccc1O.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C8H11NO.C7H6O3/c1-3-7-8(10)5-4-6(2)9-7;8-6-4-2-1-3-5(6)7(9)10/h4-5,10H,3H2,1-2H3;1-4,8H,(H,9,10) |
| InChIKey | NKBSTKVKKPAYMS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid?
The IUPAC name of 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid (CID 6611293) is 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid.
What is the SMILES notation for 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid?
The canonical SMILES for 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid is CCc1nc(C)ccc1O.O=C(O)c1ccccc1O.
What is the InChIKey of 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid?
The InChIKey is NKBSTKVKKPAYMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C7H6O3/c1-3-7-8(10)5-4-6(2)9-7;8-6-4-2-1-3-5(6)7(9)10/h4-5,10H,3H2,1-2H3;1-4,8H,(H,9,10).
What are the key properties of 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid?
2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid has a molecular weight of 275.30 g/mol, XLogP of 2.75, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-methylpyridin-3-ol;2-hydroxybenzoic acid is sourced from PubChem (CID 6611293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).