C13H19N3OS — CID 66113206
2-(3-hydroxypropylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide (PubChem CID 66113206) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-(3-hydroxypropylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide.
| Compound Name | 2-(3-hydroxypropylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide |
|---|---|
| PubChem CID | 66113206 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(3-hydroxypropylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc2c(nc1SCCCO)CCCC2 |
| InChI | InChI=1S/C13H19N3OS/c14-12(15)10-8-9-4-1-2-5-11(9)16-13(10)18-7-3-6-17/h8,17H,1-7H2,(H3,14,15) |
| InChIKey | BUJUWLKABWUSFV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|