About 3-octylsulfinylbutanoic acid
3-octylsulfinylbutanoic acid (PubChem CID 66114161) has the molecular formula C12H24O3S
and a molecular weight of 248.39 g/mol. Its IUPAC name is 3-octylsulfinylbutanoic acid.
Molecular Properties
| Compound Name | 3-octylsulfinylbutanoic acid |
| PubChem CID | 66114161 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-octylsulfinylbutanoic acid |
| SMILES | CCCCCCCCS(=O)C(C)CC(=O)O |
| InChI | InChI=1S/C12H24O3S/c1-3-4-5-6-7-8-9-16(15)11(2)10-12(13)14/h11H,3-10H2,1-2H3,(H,13,14) |
| InChIKey | DWXJJJGCQUSSPH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octylsulfinylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octylsulfinylbutanoic acid?
The IUPAC name of 3-octylsulfinylbutanoic acid (CID 66114161) is 3-octylsulfinylbutanoic acid.
What is the SMILES notation for 3-octylsulfinylbutanoic acid?
The canonical SMILES for 3-octylsulfinylbutanoic acid is CCCCCCCCS(=O)C(C)CC(=O)O.
What is the InChIKey of 3-octylsulfinylbutanoic acid?
The InChIKey is DWXJJJGCQUSSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3S/c1-3-4-5-6-7-8-9-16(15)11(2)10-12(13)14/h11H,3-10H2,1-2H3,(H,13,14).
What are the key properties of 3-octylsulfinylbutanoic acid?
3-octylsulfinylbutanoic acid has a molecular weight of 248.39 g/mol, XLogP of 2.96, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octylsulfinylbutanoic acid is sourced from PubChem (CID 66114161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).