3-octylsulfinylbutanoic acid

C12H24O3S — CID 66114161

IUPAC3-octylsulfinylbutanoic acid
SMILESCCCCCCCCS(=O)C(C)CC(=O)O
InChIInChI=1S/C12H24O3S/c1-3-4-5-6-7-8-9-16(15)11(2)10-12(13)14/h11H,3-10H2,1-2H3,(H,13,14)
InChIKeyDWXJJJGCQUSSPH-UHFFFAOYSA-N
MW248.39 g/mol
LogP2.96
Rot. Bonds10

About 3-octylsulfinylbutanoic acid

3-octylsulfinylbutanoic acid (PubChem CID 66114161) has the molecular formula C12H24O3S and a molecular weight of 248.39 g/mol. Its IUPAC name is 3-octylsulfinylbutanoic acid.

Molecular Properties

Compound Name3-octylsulfinylbutanoic acid
PubChem CID66114161
Molecular FormulaC12H24O3S
Molecular Weight248.39 g/mol
Exact Mass248.14
IUPAC Name3-octylsulfinylbutanoic acid
SMILESCCCCCCCCS(=O)C(C)CC(=O)O
InChIInChI=1S/C12H24O3S/c1-3-4-5-6-7-8-9-16(15)11(2)10-12(13)14/h11H,3-10H2,1-2H3,(H,13,14)
InChIKeyDWXJJJGCQUSSPH-UHFFFAOYSA-N
XLogP2.96
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.39
LogP ≤ 52.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-octylsulfinylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-octylsulfinylbutanoic acid?
The IUPAC name of 3-octylsulfinylbutanoic acid (CID 66114161) is 3-octylsulfinylbutanoic acid.
What is the SMILES notation for 3-octylsulfinylbutanoic acid?
The canonical SMILES for 3-octylsulfinylbutanoic acid is CCCCCCCCS(=O)C(C)CC(=O)O.
What is the InChIKey of 3-octylsulfinylbutanoic acid?
The InChIKey is DWXJJJGCQUSSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3S/c1-3-4-5-6-7-8-9-16(15)11(2)10-12(13)14/h11H,3-10H2,1-2H3,(H,13,14).
What are the key properties of 3-octylsulfinylbutanoic acid?
3-octylsulfinylbutanoic acid has a molecular weight of 248.39 g/mol, XLogP of 2.96, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octylsulfinylbutanoic acid is sourced from PubChem (CID 66114161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).