C11H16FNOS — CID 66114322
3-[2-[(1R)-1-aminoethyl]-3-fluorophenyl]sulfanylpropan-1-ol (PubChem CID 66114322) has the molecular formula C11H16FNOS and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-[2-[(1R)-1-aminoethyl]-3-fluorophenyl]sulfanylpropan-1-ol.
| Compound Name | 3-[2-[(1R)-1-aminoethyl]-3-fluorophenyl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 66114322 |
| Molecular Formula | C11H16FNOS |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-[2-[(1R)-1-aminoethyl]-3-fluorophenyl]sulfanylpropan-1-ol |
| SMILES | C[C@@H](N)c1c(F)cccc1SCCCO |
| InChI | InChI=1S/C11H16FNOS/c1-8(13)11-9(12)4-2-5-10(11)15-7-3-6-14/h2,4-5,8,14H,3,6-7,13H2,1H3/t8-/m1/s1 |
| InChIKey | QLBMHXIRMADZNS-MRVPVSSYSA-N |
| XLogP | 2.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|