About methyl 3-nonylsulfanylbutanoate
methyl 3-nonylsulfanylbutanoate (PubChem CID 66115524) has the molecular formula C14H28O2S
and a molecular weight of 260.44 g/mol. Its IUPAC name is methyl 3-nonylsulfanylbutanoate.
Molecular Properties
| Compound Name | methyl 3-nonylsulfanylbutanoate |
| PubChem CID | 66115524 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | methyl 3-nonylsulfanylbutanoate |
| SMILES | CCCCCCCCCSC(C)CC(=O)OC |
| InChI | InChI=1S/C14H28O2S/c1-4-5-6-7-8-9-10-11-17-13(2)12-14(15)16-3/h13H,4-12H2,1-3H3 |
| InChIKey | QDPBAJVINCDMFN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-nonylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-nonylsulfanylbutanoate?
The IUPAC name of methyl 3-nonylsulfanylbutanoate (CID 66115524) is methyl 3-nonylsulfanylbutanoate.
What is the SMILES notation for methyl 3-nonylsulfanylbutanoate?
The canonical SMILES for methyl 3-nonylsulfanylbutanoate is CCCCCCCCCSC(C)CC(=O)OC.
What is the InChIKey of methyl 3-nonylsulfanylbutanoate?
The InChIKey is QDPBAJVINCDMFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2S/c1-4-5-6-7-8-9-10-11-17-13(2)12-14(15)16-3/h13H,4-12H2,1-3H3.
What are the key properties of methyl 3-nonylsulfanylbutanoate?
methyl 3-nonylsulfanylbutanoate has a molecular weight of 260.44 g/mol, XLogP of 4.42, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-nonylsulfanylbutanoate is sourced from PubChem (CID 66115524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).