C8H14N2OS2 — CID 66115687
3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol (PubChem CID 66115687) has the molecular formula C8H14N2OS2 and a molecular weight of 218.35 g/mol. Its IUPAC name is 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol.
| Compound Name | 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 66115687 |
| Molecular Formula | C8H14N2OS2 |
| Molecular Weight | 218.35 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol |
| SMILES | CC(C)c1nsc(SCCCO)n1 |
| InChI | InChI=1S/C8H14N2OS2/c1-6(2)7-9-8(13-10-7)12-5-3-4-11/h6,11H,3-5H2,1-2H3 |
| InChIKey | RBGUWJBERYHIHW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|