About methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate
methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate (PubChem CID 66115770) has the molecular formula C13H22N2O4S
and a molecular weight of 302.40 g/mol. Its IUPAC name is methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate.
Molecular Properties
| Compound Name | methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate |
| PubChem CID | 66115770 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate |
| SMILES | CCc1cc(CS(=O)(=O)C(C)CC(=O)OC)n(CC)n1 |
| InChI | InChI=1S/C13H22N2O4S/c1-5-11-8-12(15(6-2)14-11)9-20(17,18)10(3)7-13(16)19-4/h8,10H,5-7,9H2,1-4H3 |
| InChIKey | PFYUURQHFFAXNA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate?
The IUPAC name of methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate (CID 66115770) is methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate.
What is the SMILES notation for methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate?
The canonical SMILES for methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate is CCc1cc(CS(=O)(=O)C(C)CC(=O)OC)n(CC)n1.
What is the InChIKey of methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate?
The InChIKey is PFYUURQHFFAXNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O4S/c1-5-11-8-12(15(6-2)14-11)9-20(17,18)10(3)7-13(16)19-4/h8,10H,5-7,9H2,1-4H3.
What are the key properties of methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate?
methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate has a molecular weight of 302.40 g/mol, XLogP of 1.33, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate is sourced from PubChem (CID 66115770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).