methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate

C13H22N2O4S — CID 66115770

IUPACmethyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate
SMILESCCc1cc(CS(=O)(=O)C(C)CC(=O)OC)n(CC)n1
InChIInChI=1S/C13H22N2O4S/c1-5-11-8-12(15(6-2)14-11)9-20(17,18)10(3)7-13(16)19-4/h8,10H,5-7,9H2,1-4H3
InChIKeyPFYUURQHFFAXNA-UHFFFAOYSA-N
MW302.40 g/mol
LogP1.33
Rot. Bonds7

About methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate

methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate (PubChem CID 66115770) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate.

Molecular Properties

Compound Namemethyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate
PubChem CID66115770
Molecular FormulaC13H22N2O4S
Molecular Weight302.40 g/mol
Exact Mass302.13
IUPAC Namemethyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate
SMILESCCc1cc(CS(=O)(=O)C(C)CC(=O)OC)n(CC)n1
InChIInChI=1S/C13H22N2O4S/c1-5-11-8-12(15(6-2)14-11)9-20(17,18)10(3)7-13(16)19-4/h8,10H,5-7,9H2,1-4H3
InChIKeyPFYUURQHFFAXNA-UHFFFAOYSA-N
XLogP1.33
TPSA78.26 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.40
LogP ≤ 51.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate?
The IUPAC name of methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate (CID 66115770) is methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate.
What is the SMILES notation for methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate?
The canonical SMILES for methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate is CCc1cc(CS(=O)(=O)C(C)CC(=O)OC)n(CC)n1.
What is the InChIKey of methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate?
The InChIKey is PFYUURQHFFAXNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O4S/c1-5-11-8-12(15(6-2)14-11)9-20(17,18)10(3)7-13(16)19-4/h8,10H,5-7,9H2,1-4H3.
What are the key properties of methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate?
methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate has a molecular weight of 302.40 g/mol, XLogP of 1.33, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]butanoate is sourced from PubChem (CID 66115770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).