3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid

C9H13NO3S2 — CID 66115944

IUPAC3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid
SMILESCc1nc(CS(=O)C(C)CC(=O)O)cs1
InChIInChI=1S/C9H13NO3S2/c1-6(3-9(11)12)15(13)5-8-4-14-7(2)10-8/h4,6H,3,5H2,1-2H3,(H,11,12)
InChIKeyMFYJLOHZMLCSBB-UHFFFAOYSA-N
MW247.34 g/mol
LogP1.56
Rot. Bonds5

About 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid

3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid (PubChem CID 66115944) has the molecular formula C9H13NO3S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid.

Molecular Properties

Compound Name3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid
PubChem CID66115944
Molecular FormulaC9H13NO3S2
Molecular Weight247.34 g/mol
Exact Mass247.03
IUPAC Name3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid
SMILESCc1nc(CS(=O)C(C)CC(=O)O)cs1
InChIInChI=1S/C9H13NO3S2/c1-6(3-9(11)12)15(13)5-8-4-14-7(2)10-8/h4,6H,3,5H2,1-2H3,(H,11,12)
InChIKeyMFYJLOHZMLCSBB-UHFFFAOYSA-N
XLogP1.56
TPSA67.26 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.34
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid?
The IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid (CID 66115944) is 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid.
What is the SMILES notation for 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid?
The canonical SMILES for 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid is Cc1nc(CS(=O)C(C)CC(=O)O)cs1.
What is the InChIKey of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid?
The InChIKey is MFYJLOHZMLCSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S2/c1-6(3-9(11)12)15(13)5-8-4-14-7(2)10-8/h4,6H,3,5H2,1-2H3,(H,11,12).
What are the key properties of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid?
3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid has a molecular weight of 247.34 g/mol, XLogP of 1.56, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]butanoic acid is sourced from PubChem (CID 66115944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).