About 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate
1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate (PubChem CID 66116354) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate |
| PubChem CID | 66116354 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate |
| SMILES | CCc1nn(C)c(C(=O)OC(C)COC)c1N |
| InChI | InChI=1S/C11H19N3O3/c1-5-8-9(12)10(14(3)13-8)11(15)17-7(2)6-16-4/h7H,5-6,12H2,1-4H3 |
| InChIKey | PZLONARJSKULNN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
The IUPAC name of 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate (CID 66116354) is 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate.
What is the SMILES notation for 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
The canonical SMILES for 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate is CCc1nn(C)c(C(=O)OC(C)COC)c1N.
What is the InChIKey of 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
The InChIKey is PZLONARJSKULNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-5-8-9(12)10(14(3)13-8)11(15)17-7(2)6-16-4/h7H,5-6,12H2,1-4H3.
What are the key properties of 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate has a molecular weight of 241.29 g/mol, XLogP of 0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate is sourced from PubChem (CID 66116354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).