C8H15N3O2 — CID 66117929
2-[(3-methylimidazol-4-yl)methylamino]propane-1,3-diol (PubChem CID 66117929) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-[(3-methylimidazol-4-yl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(3-methylimidazol-4-yl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 66117929 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-[(3-methylimidazol-4-yl)methylamino]propane-1,3-diol |
| SMILES | Cn1cncc1CNC(CO)CO |
| InChI | InChI=1S/C8H15N3O2/c1-11-6-9-2-8(11)3-10-7(4-12)5-13/h2,6-7,10,12-13H,3-5H2,1H3 |
| InChIKey | NHLUWYYBVHTRNU-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |