C9H14N4O — CID 66118126
4-amino-1-methyl-5-(3-methylimidazol-4-yl)pyrrolidin-2-one (PubChem CID 66118126) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 4-amino-1-methyl-5-(3-methylimidazol-4-yl)pyrrolidin-2-one.
| Compound Name | 4-amino-1-methyl-5-(3-methylimidazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 66118126 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 4-amino-1-methyl-5-(3-methylimidazol-4-yl)pyrrolidin-2-one |
| SMILES | CN1C(=O)CC(N)C1c1cncn1C |
| InChI | InChI=1S/C9H14N4O/c1-12-5-11-4-7(12)9-6(10)3-8(14)13(9)2/h4-6,9H,3,10H2,1-2H3 |
| InChIKey | LLYBDQDATVMGSC-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |