C9H16N4 — CID 66118161
1-(3-methylimidazol-4-yl)-N-prop-2-enylethane-1,2-diamine (PubChem CID 66118161) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(3-methylimidazol-4-yl)-N-prop-2-enylethane-1,2-diamine.
| Compound Name | 1-(3-methylimidazol-4-yl)-N-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 66118161 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-(3-methylimidazol-4-yl)-N-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCNC(CN)c1cncn1C |
| InChI | InChI=1S/C9H16N4/c1-3-4-12-8(5-10)9-6-11-7-13(9)2/h3,6-8,12H,1,4-5,10H2,2H3 |
| InChIKey | KYKWBZJKMXFBCS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|