C12H12F3N3 — CID 66118850
N-[(3-ethylimidazol-4-yl)methyl]-2,3,4-trifluoroaniline (PubChem CID 66118850) has the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. Its IUPAC name is N-[(3-ethylimidazol-4-yl)methyl]-2,3,4-trifluoroaniline.
| Compound Name | N-[(3-ethylimidazol-4-yl)methyl]-2,3,4-trifluoroaniline |
|---|---|
| PubChem CID | 66118850 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-[(3-ethylimidazol-4-yl)methyl]-2,3,4-trifluoroaniline |
| SMILES | CCn1cncc1CNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H12F3N3/c1-2-18-7-16-5-8(18)6-17-10-4-3-9(13)11(14)12(10)15/h3-5,7,17H,2,6H2,1H3 |
| InChIKey | RCPSKTHUMMUNRE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|