C12H13ClN4O — CID 66119861
4-amino-N-(2-chlorophenyl)-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 66119861) has the molecular formula C12H13ClN4O and a molecular weight of 264.72 g/mol. Its IUPAC name is 4-amino-N-(2-chlorophenyl)-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(2-chlorophenyl)-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66119861 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-amino-N-(2-chlorophenyl)-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)Nc2ccccc2Cl)c1N |
| InChI | InChI=1S/C12H13ClN4O/c1-7-10(14)11(17(2)16-7)12(18)15-9-6-4-3-5-8(9)13/h3-6H,14H2,1-2H3,(H,15,18) |
| InChIKey | RXPDWYZLYXPKLK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |