C18H13N3O — CID 661203
16-methyl-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-4,5-dicarbonitrile (PubChem CID 661203) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is 16-methyl-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-4,5-dicarbonitrile.
| Compound Name | 16-methyl-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 661203 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 16-methyl-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-4,5-dicarbonitrile |
| SMILES | CC1CCc2cccc3c2N1c1cc(C#N)c(C#N)cc1O3 |
| InChI | InChI=1S/C18H13N3O/c1-11-5-6-12-3-2-4-16-18(12)21(11)15-7-13(9-19)14(10-20)8-17(15)22-16/h2-4,7-8,11H,5-6H2,1H3 |
| InChIKey | JCYACCBTORWINZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |