C8H13N5OS — CID 66120897
[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]thiourea (PubChem CID 66120897) has the molecular formula C8H13N5OS and a molecular weight of 227.29 g/mol. Its IUPAC name is [(2-ethyl-5-methylpyrazole-3-carbonyl)amino]thiourea.
| Compound Name | [(2-ethyl-5-methylpyrazole-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 66120897 |
| Molecular Formula | C8H13N5OS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | [(2-ethyl-5-methylpyrazole-3-carbonyl)amino]thiourea |
| SMILES | CCn1nc(C)cc1C(=O)NNC(N)=S |
| InChI | InChI=1S/C8H13N5OS/c1-3-13-6(4-5(2)12-13)7(14)10-11-8(9)15/h4H,3H2,1-2H3,(H,10,14)(H3,9,11,15) |
| InChIKey | NAXWWIHYWOWPJS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|