About (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone
(4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone (PubChem CID 66121179) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone.
Molecular Properties
| Compound Name | (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone |
| PubChem CID | 66121179 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone |
| SMILES | CCc1cc(C(=O)N2CCc3c(N)cccc32)n(CC)n1 |
| InChI | InChI=1S/C16H20N4O/c1-3-11-10-15(20(4-2)18-11)16(21)19-9-8-12-13(17)6-5-7-14(12)19/h5-7,10H,3-4,8-9,17H2,1-2H3 |
| InChIKey | JPMRPIIPFOWJKS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone?
The IUPAC name of (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone (CID 66121179) is (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone.
What is the SMILES notation for (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone?
The canonical SMILES for (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone is CCc1cc(C(=O)N2CCc3c(N)cccc32)n(CC)n1.
What is the InChIKey of (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone?
The InChIKey is JPMRPIIPFOWJKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O/c1-3-11-10-15(20(4-2)18-11)16(21)19-9-8-12-13(17)6-5-7-14(12)19/h5-7,10H,3-4,8-9,17H2,1-2H3.
What are the key properties of (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone?
(4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone has a molecular weight of 284.36 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2,3-dihydroindol-1-yl)-(1,3-diethylpyrazol-5-yl)methanone is sourced from PubChem (CID 66121179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).