C9H13N5O — CID 66121190
5-(1,3-diethylpyrazol-5-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 66121190) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 5-(1,3-diethylpyrazol-5-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1,3-diethylpyrazol-5-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 66121190 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 5-(1,3-diethylpyrazol-5-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCc1cc(-c2nnc(N)o2)n(CC)n1 |
| InChI | InChI=1S/C9H13N5O/c1-3-6-5-7(14(4-2)13-6)8-11-12-9(10)15-8/h5H,3-4H2,1-2H3,(H2,10,12) |
| InChIKey | IRSGGAHQMYCQHP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |