C12H18NO2PS — CID 6612189
N,N-diethyl-3-sulfanylidene-1,5-dihydro-2,4,3λ5-benzodioxaphosphepin-3-amine (PubChem CID 6612189) has the molecular formula C12H18NO2PS and a molecular weight of 271.32 g/mol. Its IUPAC name is N,N-diethyl-3-sulfanylidene-1,5-dihydro-2,4,3λ5-benzodioxaphosphepin-3-amine.
| Compound Name | N,N-diethyl-3-sulfanylidene-1,5-dihydro-2,4,3λ5-benzodioxaphosphepin-3-amine |
|---|---|
| PubChem CID | 6612189 |
| Molecular Formula | C12H18NO2PS |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N,N-diethyl-3-sulfanylidene-1,5-dihydro-2,4,3λ5-benzodioxaphosphepin-3-amine |
| SMILES | CCN(CC)P1(=S)OCc2ccccc2CO1 |
| InChI | InChI=1S/C12H18NO2PS/c1-3-13(4-2)16(17)14-9-11-7-5-6-8-12(11)10-15-16/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | XNHXAPXTZCQENN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|