About 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide
4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide (PubChem CID 66123805) has the molecular formula C14H25N5O
and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide |
| PubChem CID | 66123805 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide |
| SMILES | CCCN1CCC(NC(=O)c2c(N)c(C)nn2C)CC1 |
| InChI | InChI=1S/C14H25N5O/c1-4-7-19-8-5-11(6-9-19)16-14(20)13-12(15)10(2)17-18(13)3/h11H,4-9,15H2,1-3H3,(H,16,20) |
| InChIKey | DHPXQGFDTZKCDB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide?
The IUPAC name of 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide (CID 66123805) is 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide.
What is the SMILES notation for 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide?
The canonical SMILES for 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide is CCCN1CCC(NC(=O)c2c(N)c(C)nn2C)CC1.
What is the InChIKey of 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide?
The InChIKey is DHPXQGFDTZKCDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N5O/c1-4-7-19-8-5-11(6-9-19)16-14(20)13-12(15)10(2)17-18(13)3/h11H,4-9,15H2,1-3H3,(H,16,20).
What are the key properties of 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide?
4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide has a molecular weight of 279.39 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,3-dimethyl-N-(1-propylpiperidin-4-yl)pyrazole-5-carboxamide is sourced from PubChem (CID 66123805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).