About thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate
thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate (PubChem CID 66123924) has the molecular formula C12H15N3O2S
and a molecular weight of 265.34 g/mol. Its IUPAC name is thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate |
| PubChem CID | 66123924 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate |
| SMILES | CCn1nc(C)c(N)c1C(=O)OCc1ccsc1 |
| InChI | InChI=1S/C12H15N3O2S/c1-3-15-11(10(13)8(2)14-15)12(16)17-6-9-4-5-18-7-9/h4-5,7H,3,6,13H2,1-2H3 |
| InChIKey | ZCGPHJOMJOEZBQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate?
The IUPAC name of thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate (CID 66123924) is thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate.
What is the SMILES notation for thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate?
The canonical SMILES for thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate is CCn1nc(C)c(N)c1C(=O)OCc1ccsc1.
What is the InChIKey of thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate?
The InChIKey is ZCGPHJOMJOEZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S/c1-3-15-11(10(13)8(2)14-15)12(16)17-6-9-4-5-18-7-9/h4-5,7H,3,6,13H2,1-2H3.
What are the key properties of thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate?
thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate has a molecular weight of 265.34 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-ylmethyl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate is sourced from PubChem (CID 66123924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).