About oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate
oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 66124028) has the molecular formula C10H15N3O3
and a molecular weight of 225.25 g/mol. Its IUPAC name is oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate |
| PubChem CID | 66124028 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate |
| SMILES | Cc1nn(C)c(C(=O)OC2CCOC2)c1N |
| InChI | InChI=1S/C10H15N3O3/c1-6-8(11)9(13(2)12-6)10(14)16-7-3-4-15-5-7/h7H,3-5,11H2,1-2H3 |
| InChIKey | MESPBIZPUURYCQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The IUPAC name of oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate (CID 66124028) is oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate.
What is the SMILES notation for oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The canonical SMILES for oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate is Cc1nn(C)c(C(=O)OC2CCOC2)c1N.
What is the InChIKey of oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The InChIKey is MESPBIZPUURYCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-6-8(11)9(13(2)12-6)10(14)16-7-3-4-15-5-7/h7H,3-5,11H2,1-2H3.
What are the key properties of oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate has a molecular weight of 225.25 g/mol, XLogP of 0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 4-amino-1,3-dimethylpyrazole-5-carboxylate is sourced from PubChem (CID 66124028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).