About 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide
4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide (PubChem CID 66124389) has the molecular formula C11H18N4O3S
and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide |
| PubChem CID | 66124389 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)NC2(C)CCS(=O)(=O)C2)c1N |
| InChI | InChI=1S/C11H18N4O3S/c1-7-8(12)9(15(3)14-7)10(16)13-11(2)4-5-19(17,18)6-11/h4-6,12H2,1-3H3,(H,13,16) |
| InChIKey | LTUZDYNDHGXORZ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide?
The IUPAC name of 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide (CID 66124389) is 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide.
What is the SMILES notation for 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide?
The canonical SMILES for 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide is Cc1nn(C)c(C(=O)NC2(C)CCS(=O)(=O)C2)c1N.
What is the InChIKey of 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide?
The InChIKey is LTUZDYNDHGXORZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3S/c1-7-8(12)9(15(3)14-7)10(16)13-11(2)4-5-19(17,18)6-11/h4-6,12H2,1-3H3,(H,13,16).
What are the key properties of 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide?
4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide has a molecular weight of 286.36 g/mol, XLogP of -0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,3-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrazole-5-carboxamide is sourced from PubChem (CID 66124389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).