About (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone
(4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 66124798) has the molecular formula C12H17F3N4O
and a molecular weight of 290.29 g/mol. Its IUPAC name is (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone |
| PubChem CID | 66124798 |
| Molecular Formula | C12H17F3N4O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | Cc1nn(C)c(C(=O)N2CCC(C(F)(F)F)CC2)c1N |
| InChI | InChI=1S/C12H17F3N4O/c1-7-9(16)10(18(2)17-7)11(20)19-5-3-8(4-6-19)12(13,14)15/h8H,3-6,16H2,1-2H3 |
| InChIKey | WMGGOXVVMHCXDM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone?
The IUPAC name of (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone (CID 66124798) is (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone.
What is the SMILES notation for (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone?
The canonical SMILES for (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone is Cc1nn(C)c(C(=O)N2CCC(C(F)(F)F)CC2)c1N.
What is the InChIKey of (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone?
The InChIKey is WMGGOXVVMHCXDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N4O/c1-7-9(16)10(18(2)17-7)11(20)19-5-3-8(4-6-19)12(13,14)15/h8H,3-6,16H2,1-2H3.
What are the key properties of (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone?
(4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone has a molecular weight of 290.29 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1,3-dimethylpyrazol-5-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone is sourced from PubChem (CID 66124798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).