About [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate
[2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 66125383) has the molecular formula C12H20N4O3
and a molecular weight of 268.32 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate |
| PubChem CID | 66125383 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate |
| SMILES | Cc1nn(C)c(C(=O)OCC(=O)NCC(C)C)c1N |
| InChI | InChI=1S/C12H20N4O3/c1-7(2)5-14-9(17)6-19-12(18)11-10(13)8(3)15-16(11)4/h7H,5-6,13H2,1-4H3,(H,14,17) |
| InChIKey | JNKXMOGRFLNYBS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The IUPAC name of [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate (CID 66125383) is [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate.
What is the SMILES notation for [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The canonical SMILES for [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate is Cc1nn(C)c(C(=O)OCC(=O)NCC(C)C)c1N.
What is the InChIKey of [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The InChIKey is JNKXMOGRFLNYBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3/c1-7(2)5-14-9(17)6-19-12(18)11-10(13)8(3)15-16(11)4/h7H,5-6,13H2,1-4H3,(H,14,17).
What are the key properties of [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate?
[2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate has a molecular weight of 268.32 g/mol, XLogP of 0.24, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methylpropylamino)-2-oxoethyl] 4-amino-1,3-dimethylpyrazole-5-carboxylate is sourced from PubChem (CID 66125383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).