About 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol
3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol (PubChem CID 66126008) has the molecular formula C11H23NOS
and a molecular weight of 217.38 g/mol. Its IUPAC name is 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol.
Molecular Properties
| Compound Name | 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol |
| PubChem CID | 66126008 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol |
| SMILES | CC1CC(C)C(SCCCO)C(N)C1 |
| InChI | InChI=1S/C11H23NOS/c1-8-6-9(2)11(10(12)7-8)14-5-3-4-13/h8-11,13H,3-7,12H2,1-2H3 |
| InChIKey | UJIGBNRUPIBVMO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol?
The IUPAC name of 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol (CID 66126008) is 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol.
What is the SMILES notation for 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol?
The canonical SMILES for 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol is CC1CC(C)C(SCCCO)C(N)C1.
What is the InChIKey of 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol?
The InChIKey is UJIGBNRUPIBVMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NOS/c1-8-6-9(2)11(10(12)7-8)14-5-3-4-13/h8-11,13H,3-7,12H2,1-2H3.
What are the key properties of 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol?
3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol has a molecular weight of 217.38 g/mol, XLogP of 1.86, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4,6-dimethylcyclohexyl)sulfanylpropan-1-ol is sourced from PubChem (CID 66126008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).