C14H17N3O6 — CID 6612605
[(3S,6S)-3-acetyloxy-6-(1-azidobut-3-yn-2-yloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 6612605) has the molecular formula C14H17N3O6 and a molecular weight of 323.31 g/mol. Its IUPAC name is [(3S,6S)-3-acetyloxy-6-(1-azidobut-3-yn-2-yloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(3S,6S)-3-acetyloxy-6-(1-azidobut-3-yn-2-yloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 6612605 |
| Molecular Formula | C14H17N3O6 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | [(3S,6S)-3-acetyloxy-6-(1-azidobut-3-yn-2-yloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C#CC(CN=[N+]=[N-])O[C@@H]1C=C[C@H](OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C14H17N3O6/c1-4-11(7-16-17-15)22-14-6-5-12(21-10(3)19)13(23-14)8-20-9(2)18/h1,5-6,11-14H,7-8H2,2-3H3/t11?,12-,13?,14-/m0/s1 |
| InChIKey | FWKKTKXJAXTHNR-YIOUJQMASA-N |
| XLogP | 1.09 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|