C12H17N3O5 — CID 66126115
(2S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]pentanedioic acid (PubChem CID 66126115) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is (2S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 66126115 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]pentanedioic acid |
| SMILES | CCn1nc(C)cc1C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H17N3O5/c1-3-15-9(6-7(2)14-15)11(18)13-8(12(19)20)4-5-10(16)17/h6,8H,3-5H2,1-2H3,(H,13,18)(H,16,17)(H,19,20)/t8-/m0/s1 |
| InChIKey | OHWQCUNYAFOJDQ-QMMMGPOBSA-N |
| XLogP | 0.26 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |