C22H30O9 — CID 6612668
[(1R,2S,13S)-16,16-dimethyl-4,11-dioxo-3,12,15,17,19-pentaoxatricyclo[11.6.0.014,18]nonadec-7-en-2-yl]methyl pent-4-enoate (PubChem CID 6612668) has the molecular formula C22H30O9 and a molecular weight of 438.47 g/mol. Its IUPAC name is [(1R,2S,13S)-16,16-dimethyl-4,11-dioxo-3,12,15,17,19-pentaoxatricyclo[11.6.0.014,18]nonadec-7-en-2-yl]methyl pent-4-enoate.
| Compound Name | [(1R,2S,13S)-16,16-dimethyl-4,11-dioxo-3,12,15,17,19-pentaoxatricyclo[11.6.0.014,18]nonadec-7-en-2-yl]methyl pent-4-enoate |
|---|---|
| PubChem CID | 6612668 |
| Molecular Formula | C22H30O9 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [(1R,2S,13S)-16,16-dimethyl-4,11-dioxo-3,12,15,17,19-pentaoxatricyclo[11.6.0.014,18]nonadec-7-en-2-yl]methyl pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@@H]1OC(=O)CCC=CCCC(=O)O[C@@H]2C3OC(C)(C)OC3O[C@H]12 |
| InChI | InChI=1S/C22H30O9/c1-4-5-10-15(23)26-13-14-18-19(20-21(29-18)31-22(2,3)30-20)28-17(25)12-9-7-6-8-11-16(24)27-14/h4,6-7,14,18-21H,1,5,8-13H2,2-3H3/t14-,18+,19-,20?,21?/m0/s1 |
| InChIKey | UMVQFHGWORZOMP-OQPFHGLCSA-N |
| XLogP | 2.33 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|