About [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate
[(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate (PubChem CID 6612738) has the molecular formula C18H28O6Si
and a molecular weight of 368.50 g/mol. Its IUPAC name is [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate.
Molecular Properties
| Compound Name | [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate |
| PubChem CID | 6612738 |
| Molecular Formula | C18H28O6Si |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate |
| SMILES | C#C[Si](OCC1OC=CC(OC(C)=O)[C@@H]1OC(C)=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H28O6Si/c1-8-25(12(2)3,13(4)5)22-11-17-18(24-15(7)20)16(9-10-21-17)23-14(6)19/h1,9-10,12-13,16-18H,11H2,2-7H3/t16?,17?,18-/m0/s1 |
| InChIKey | LKYDPCIMHPEFPV-ABHNRTSZSA-N |
| XLogP | 2.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate?
The IUPAC name of [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate (CID 6612738) is [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate.
What is the SMILES notation for [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate?
The canonical SMILES for [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate is C#C[Si](OCC1OC=CC(OC(C)=O)[C@@H]1OC(C)=O)(C(C)C)C(C)C.
What is the InChIKey of [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate?
The InChIKey is LKYDPCIMHPEFPV-ABHNRTSZSA-N. The full InChI is InChI=1S/C18H28O6Si/c1-8-25(12(2)3,13(4)5)22-11-17-18(24-15(7)20)16(9-10-21-17)23-14(6)19/h1,9-10,12-13,16-18H,11H2,2-7H3/t16?,17?,18-/m0/s1.
What are the key properties of [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate?
[(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate has a molecular weight of 368.50 g/mol, XLogP of 2.72, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-acetyloxy-2-[[ethynyl-di(propan-2-yl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate is sourced from PubChem (CID 6612738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).