C30H25BrFNO4 — CID 6612792
(6R,6aS,10aR)-6-(3-bromo-4-fluorophenyl)-6a,8-dimethyl-2-phenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6612792) has the molecular formula C30H25BrFNO4 and a molecular weight of 562.44 g/mol. Its IUPAC name is (6R,6aS,10aR)-6-(3-bromo-4-fluorophenyl)-6a,8-dimethyl-2-phenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (6R,6aS,10aR)-6-(3-bromo-4-fluorophenyl)-6a,8-dimethyl-2-phenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6612792 |
| Molecular Formula | C30H25BrFNO4 |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | (6R,6aS,10aR)-6-(3-bromo-4-fluorophenyl)-6a,8-dimethyl-2-phenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)[C@@H]2CC3C(=CCC4C(=O)N(c5ccccc5)C(=O)C43)[C@H](c3ccc(F)c(Br)c3)[C@]2(C)C1=O |
| InChI | InChI=1S/C30H25BrFNO4/c1-15-12-24(34)21-14-20-18(26(30(21,2)27(15)35)16-8-11-23(32)22(31)13-16)9-10-19-25(20)29(37)33(28(19)36)17-6-4-3-5-7-17/h3-9,11-13,19-21,25-26H,10,14H2,1-2H3/t19?,20?,21-,25?,26-,30+/m0/s1 |
| InChIKey | HXMVXDLQJWTXSU-VBQWBPOQSA-N |
| XLogP | 5.55 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|