C27H26N4O3 — CID 6612811
(1S)-16-acetyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetrazahexacyclo[12.10.0.02,11.04,9.015,23.017,22]tetracosa-2,4,6,8,17,19,21-heptaene-10,13-dione (PubChem CID 6612811) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is (1S)-16-acetyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetrazahexacyclo[12.10.0.02,11.04,9.015,23.017,22]tetracosa-2,4,6,8,17,19,21-heptaene-10,13-dione.
| Compound Name | (1S)-16-acetyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetrazahexacyclo[12.10.0.02,11.04,9.015,23.017,22]tetracosa-2,4,6,8,17,19,21-heptaene-10,13-dione |
|---|---|
| PubChem CID | 6612811 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (1S)-16-acetyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetrazahexacyclo[12.10.0.02,11.04,9.015,23.017,22]tetracosa-2,4,6,8,17,19,21-heptaene-10,13-dione |
| SMILES | C=CC(C)(C)C12C[C@H]3c4nc5ccccc5c(=O)n4CC(=O)N3C1N(C(C)=O)c1ccccc12 |
| InChI | InChI=1S/C27H26N4O3/c1-5-26(3,4)27-14-21-23-28-19-12-8-6-10-17(19)24(34)29(23)15-22(33)31(21)25(27)30(16(2)32)20-13-9-7-11-18(20)27/h5-13,21,25H,1,14-15H2,2-4H3/t21-,25?,27?/m0/s1 |
| InChIKey | CKEYNBMZMHSDRS-WSFMRIJLSA-N |
| XLogP | 3.53 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|