C12H17N5O — CID 66128615
2-[4-(2,5-dimethylpyrazole-3-carbonyl)piperazin-1-yl]acetonitrile (PubChem CID 66128615) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylpyrazole-3-carbonyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-(2,5-dimethylpyrazole-3-carbonyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 66128615 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-[4-(2,5-dimethylpyrazole-3-carbonyl)piperazin-1-yl]acetonitrile |
| SMILES | Cc1cc(C(=O)N2CCN(CC#N)CC2)n(C)n1 |
| InChI | InChI=1S/C12H17N5O/c1-10-9-11(15(2)14-10)12(18)17-7-5-16(4-3-13)6-8-17/h9H,4-8H2,1-2H3 |
| InChIKey | ODPRJQGHKOWDNJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|