C14H11N3S — CID 661300
2,5-diphenyl-1H-1,2,4-triazole-3-thione (PubChem CID 661300) has the molecular formula C14H11N3S and a molecular weight of 253.33 g/mol. Its IUPAC name is 2,5-diphenyl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2,5-diphenyl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 661300 |
| Molecular Formula | C14H11N3S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2,5-diphenyl-1H-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2ccccc2)[nH]n1-c1ccccc1 |
| InChI | InChI=1S/C14H11N3S/c18-14-15-13(11-7-3-1-4-8-11)16-17(14)12-9-5-2-6-10-12/h1-10H,(H,15,16,18) |
| InChIKey | ZUEBSLXIWLEWET-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|